C11H17NO4S2 — CID 47072937
ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]propanoate (PubChem CID 47072937) has the molecular formula C11H17NO4S2 and a molecular weight of 291.39 g/mol. Its IUPAC name is ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]propanoate.
| Compound Name | ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 47072937 |
| Molecular Formula | C11H17NO4S2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)C(C)NS(=O)(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C11H17NO4S2/c1-5-16-11(13)8(3)12-18(14,15)10-6-7(2)17-9(10)4/h6,8,12H,5H2,1-4H3 |
| InChIKey | AREZGAPNTDWPJP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |