C10H18N2O3S2 — CID 64542146
N-(2-amino-3-hydroxybutyl)-2,5-dimethylthiophene-3-sulfonamide (PubChem CID 64542146) has the molecular formula C10H18N2O3S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(2-amino-3-hydroxybutyl)-2,5-dimethylthiophene-3-sulfonamide.
| Compound Name | N-(2-amino-3-hydroxybutyl)-2,5-dimethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 64542146 |
| Molecular Formula | C10H18N2O3S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N-(2-amino-3-hydroxybutyl)-2,5-dimethylthiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC(N)C(C)O)c(C)s1 |
| InChI | InChI=1S/C10H18N2O3S2/c1-6-4-10(8(3)16-6)17(14,15)12-5-9(11)7(2)13/h4,7,9,12-13H,5,11H2,1-3H3 |
| InChIKey | PQUPZAQWWSTBRG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |