C9H16N2O2S2 — CID 62658925
2,5-dimethyl-N-[2-(methylamino)ethyl]thiophene-3-sulfonamide (PubChem CID 62658925) has the molecular formula C9H16N2O2S2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-(methylamino)ethyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-[2-(methylamino)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 62658925 |
| Molecular Formula | C9H16N2O2S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2,5-dimethyl-N-[2-(methylamino)ethyl]thiophene-3-sulfonamide |
| SMILES | CNCCNS(=O)(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C9H16N2O2S2/c1-7-6-9(8(2)14-7)15(12,13)11-5-4-10-3/h6,10-11H,4-5H2,1-3H3 |
| InChIKey | YUFKMUPQGOFGHQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|