C15H15F2N3O2S2 — CID 133387815
N-[2-(4-cyano-2,6-difluoroanilino)ethyl]-2,5-dimethylthiophene-3-sulfonamide (PubChem CID 133387815) has the molecular formula C15H15F2N3O2S2 and a molecular weight of 371.43 g/mol. Its IUPAC name is N-[2-(4-cyano-2,6-difluoroanilino)ethyl]-2,5-dimethylthiophene-3-sulfonamide.
| Compound Name | N-[2-(4-cyano-2,6-difluoroanilino)ethyl]-2,5-dimethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 133387815 |
| Molecular Formula | C15H15F2N3O2S2 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-[2-(4-cyano-2,6-difluoroanilino)ethyl]-2,5-dimethylthiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCNc2c(F)cc(C#N)cc2F)c(C)s1 |
| InChI | InChI=1S/C15H15F2N3O2S2/c1-9-5-14(10(2)23-9)24(21,22)20-4-3-19-15-12(16)6-11(8-18)7-13(15)17/h5-7,19-20H,3-4H2,1-2H3 |
| InChIKey | SOCYSRNEZMUADG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|