C15H13F2N3O2S — CID 51101942
4-[(4-cyano-2,6-difluoroanilino)methyl]-N-methylbenzenesulfonamide (PubChem CID 51101942) has the molecular formula C15H13F2N3O2S and a molecular weight of 337.35 g/mol. Its IUPAC name is 4-[(4-cyano-2,6-difluoroanilino)methyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-[(4-cyano-2,6-difluoroanilino)methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 51101942 |
| Molecular Formula | C15H13F2N3O2S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 4-[(4-cyano-2,6-difluoroanilino)methyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(CNc2c(F)cc(C#N)cc2F)cc1 |
| InChI | InChI=1S/C15H13F2N3O2S/c1-19-23(21,22)12-4-2-10(3-5-12)9-20-15-13(16)6-11(8-18)7-14(15)17/h2-7,19-20H,9H2,1H3 |
| InChIKey | RSJSMPFTROKHEG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |