C11H9F5N2 — CID 79040621
3,5-difluoro-4-(4,4,4-trifluorobutylamino)benzonitrile (PubChem CID 79040621) has the molecular formula C11H9F5N2 and a molecular weight of 264.20 g/mol. Its IUPAC name is 3,5-difluoro-4-(4,4,4-trifluorobutylamino)benzonitrile.
| Compound Name | 3,5-difluoro-4-(4,4,4-trifluorobutylamino)benzonitrile |
|---|---|
| PubChem CID | 79040621 |
| Molecular Formula | C11H9F5N2 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3,5-difluoro-4-(4,4,4-trifluorobutylamino)benzonitrile |
| SMILES | N#Cc1cc(F)c(NCCCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C11H9F5N2/c12-8-4-7(6-17)5-9(13)10(8)18-3-1-2-11(14,15)16/h4-5,18H,1-3H2 |
| InChIKey | GJXPWJMYPHYITC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|