C9H9F2N3 — CID 81294761
4-(2-aminoethylamino)-3,5-difluorobenzonitrile (PubChem CID 81294761) has the molecular formula C9H9F2N3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 4-(2-aminoethylamino)-3,5-difluorobenzonitrile.
| Compound Name | 4-(2-aminoethylamino)-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 81294761 |
| Molecular Formula | C9H9F2N3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 4-(2-aminoethylamino)-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(NCCN)c(F)c1 |
| InChI | InChI=1S/C9H9F2N3/c10-7-3-6(5-13)4-8(11)9(7)14-2-1-12/h3-4,14H,1-2,12H2 |
| InChIKey | TWTHNGLMBYVXGO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |