C14H17F2N3O — CID 81293460
3,5-difluoro-4-(2-piperidin-4-yloxyethylamino)benzonitrile (PubChem CID 81293460) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is 3,5-difluoro-4-(2-piperidin-4-yloxyethylamino)benzonitrile.
| Compound Name | 3,5-difluoro-4-(2-piperidin-4-yloxyethylamino)benzonitrile |
|---|---|
| PubChem CID | 81293460 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3,5-difluoro-4-(2-piperidin-4-yloxyethylamino)benzonitrile |
| SMILES | N#Cc1cc(F)c(NCCOC2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C14H17F2N3O/c15-12-7-10(9-17)8-13(16)14(12)19-5-6-20-11-1-3-18-4-2-11/h7-8,11,18-19H,1-6H2 |
| InChIKey | WVDMPHPLPVOEBJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|