C11H17FN4O — CID 104606342
5-fluoro-N-(2-piperidin-4-yloxyethyl)pyrimidin-2-amine (PubChem CID 104606342) has the molecular formula C11H17FN4O and a molecular weight of 240.28 g/mol. Its IUPAC name is 5-fluoro-N-(2-piperidin-4-yloxyethyl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-(2-piperidin-4-yloxyethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 104606342 |
| Molecular Formula | C11H17FN4O |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-fluoro-N-(2-piperidin-4-yloxyethyl)pyrimidin-2-amine |
| SMILES | Fc1cnc(NCCOC2CCNCC2)nc1 |
| InChI | InChI=1S/C11H17FN4O/c12-9-7-15-11(16-8-9)14-5-6-17-10-1-3-13-4-2-10/h7-8,10,13H,1-6H2,(H,14,15,16) |
| InChIKey | ZUEZARCUDNWFGC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|