C11H18ClN5O2 — CID 63869500
4-chloro-6-methoxy-N-(2-piperidin-4-yloxyethyl)-1,3,5-triazin-2-amine (PubChem CID 63869500) has the molecular formula C11H18ClN5O2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 4-chloro-6-methoxy-N-(2-piperidin-4-yloxyethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-methoxy-N-(2-piperidin-4-yloxyethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63869500 |
| Molecular Formula | C11H18ClN5O2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-chloro-6-methoxy-N-(2-piperidin-4-yloxyethyl)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(Cl)nc(NCCOC2CCNCC2)n1 |
| InChI | InChI=1S/C11H18ClN5O2/c1-18-11-16-9(12)15-10(17-11)14-6-7-19-8-2-4-13-5-3-8/h8,13H,2-7H2,1H3,(H,14,15,16,17) |
| InChIKey | DYOFTAYZJVJDRL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|