C9H16N4OS — CID 65275900
N-(2-piperidin-4-yloxyethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65275900) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is N-(2-piperidin-4-yloxyethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-piperidin-4-yloxyethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65275900 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N-(2-piperidin-4-yloxyethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | c1nsc(NCCOC2CCNCC2)n1 |
| InChI | InChI=1S/C9H16N4OS/c1-3-10-4-2-8(1)14-6-5-11-9-12-7-13-15-9/h7-8,10H,1-6H2,(H,11,12,13) |
| InChIKey | PFRYIOWJTHIOOT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|