About 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine
2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine (PubChem CID 63902488) has the molecular formula C11H19N3OS
and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine.
Molecular Properties
| Compound Name | 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine |
| PubChem CID | 63902488 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine |
| SMILES | c1nc(CNCCOC2CCNCC2)cs1 |
| InChI | InChI=1S/C11H19N3OS/c1-3-12-4-2-11(1)15-6-5-13-7-10-8-16-9-14-10/h8-9,11-13H,1-7H2 |
| InChIKey | JNTKAMKQTYKITG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine?
The IUPAC name of 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine (CID 63902488) is 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine.
What is the SMILES notation for 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine?
The canonical SMILES for 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine is c1nc(CNCCOC2CCNCC2)cs1.
What is the InChIKey of 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine?
The InChIKey is JNTKAMKQTYKITG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3OS/c1-3-12-4-2-11(1)15-6-5-13-7-10-8-16-9-14-10/h8-9,11-13H,1-7H2.
What are the key properties of 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine?
2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine has a molecular weight of 241.36 g/mol, XLogP of 1.00, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-yloxy-N-(1,3-thiazol-4-ylmethyl)ethanamine is sourced from PubChem (CID 63902488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).