C10H16N2S — CID 115639498
3-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine (PubChem CID 115639498) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 3-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine.
| Compound Name | 3-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 115639498 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 3-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
| SMILES | c1nc(CNCCCC2CC2)cs1 |
| InChI | InChI=1S/C10H16N2S/c1(2-9-3-4-9)5-11-6-10-7-13-8-12-10/h7-9,11H,1-6H2 |
| InChIKey | BJHWCENGBDDMEK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|