C11H14N2S2 — CID 115883663
N-(1,3-thiazol-4-ylmethyl)-3-thiophen-2-ylpropan-1-amine (PubChem CID 115883663) has the molecular formula C11H14N2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is N-(1,3-thiazol-4-ylmethyl)-3-thiophen-2-ylpropan-1-amine.
| Compound Name | N-(1,3-thiazol-4-ylmethyl)-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 115883663 |
| Molecular Formula | C11H14N2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | N-(1,3-thiazol-4-ylmethyl)-3-thiophen-2-ylpropan-1-amine |
| SMILES | c1csc(CCCNCc2cscn2)c1 |
| InChI | InChI=1S/C11H14N2S2/c1(3-11-4-2-6-15-11)5-12-7-10-8-14-9-13-10/h2,4,6,8-9,12H,1,3,5,7H2 |
| InChIKey | RAUGYIIXKVVOEJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|