C14H17NS — CID 83456686
N-benzyl-3-thiophen-2-ylpropan-1-amine (PubChem CID 83456686) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is N-benzyl-3-thiophen-2-ylpropan-1-amine.
| Compound Name | N-benzyl-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 83456686 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-benzyl-3-thiophen-2-ylpropan-1-amine |
| SMILES | c1ccc(CNCCCc2cccs2)cc1 |
| InChI | InChI=1S/C14H17NS/c1-2-6-13(7-3-1)12-15-10-4-8-14-9-5-11-16-14/h1-3,5-7,9,11,15H,4,8,10,12H2 |
| InChIKey | BFWIFYQPCSJLCO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|