C13H13F2NS — CID 115767520
N-[(3,5-difluorophenyl)methyl]-2-thiophen-2-ylethanamine (PubChem CID 115767520) has the molecular formula C13H13F2NS and a molecular weight of 253.32 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-2-thiophen-2-ylethanamine.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 115767520 |
| Molecular Formula | C13H13F2NS |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-2-thiophen-2-ylethanamine |
| SMILES | Fc1cc(F)cc(CNCCc2cccs2)c1 |
| InChI | InChI=1S/C13H13F2NS/c14-11-6-10(7-12(15)8-11)9-16-4-3-13-2-1-5-17-13/h1-2,5-8,16H,3-4,9H2 |
| InChIKey | YEQQCHLXBDWSJB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|