C16H21FN2S — CID 62574525
N'-[(3-fluorophenyl)methyl]-N'-methyl-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine (PubChem CID 62574525) has the molecular formula C16H21FN2S and a molecular weight of 292.42 g/mol. Its IUPAC name is N'-[(3-fluorophenyl)methyl]-N'-methyl-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine.
| Compound Name | N'-[(3-fluorophenyl)methyl]-N'-methyl-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62574525 |
| Molecular Formula | C16H21FN2S |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N'-[(3-fluorophenyl)methyl]-N'-methyl-N-(2-thiophen-2-ylethyl)ethane-1,2-diamine |
| SMILES | CN(CCNCCc1cccs1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN2S/c1-19(13-14-4-2-5-15(17)12-14)10-9-18-8-7-16-6-3-11-20-16/h2-6,11-12,18H,7-10,13H2,1H3 |
| InChIKey | JEGWEYIWVGNPQA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|