C14H23FN2 — CID 62418448
N'-[(3-fluorophenyl)methyl]-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 62418448) has the molecular formula C14H23FN2 and a molecular weight of 238.35 g/mol. Its IUPAC name is N'-[(3-fluorophenyl)methyl]-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-[(3-fluorophenyl)methyl]-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62418448 |
| Molecular Formula | C14H23FN2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | N'-[(3-fluorophenyl)methyl]-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CNCCN(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C14H23FN2/c1-12(2)10-16-7-8-17(3)11-13-5-4-6-14(15)9-13/h4-6,9,12,16H,7-8,10-11H2,1-3H3 |
| InChIKey | LCSZJWZJKSYPOG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|