C14H22BrFN2 — CID 107951092
N'-[(3-bromo-2-fluorophenyl)methyl]-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 107951092) has the molecular formula C14H22BrFN2 and a molecular weight of 317.25 g/mol. Its IUPAC name is N'-[(3-bromo-2-fluorophenyl)methyl]-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-[(3-bromo-2-fluorophenyl)methyl]-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 107951092 |
| Molecular Formula | C14H22BrFN2 |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N'-[(3-bromo-2-fluorophenyl)methyl]-N'-methyl-N-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CNCCN(C)Cc1cccc(Br)c1F |
| InChI | InChI=1S/C14H22BrFN2/c1-11(2)9-17-7-8-18(3)10-12-5-4-6-13(15)14(12)16/h4-6,11,17H,7-10H2,1-3H3 |
| InChIKey | JOJXDCKNLUKEPI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|