C16H21BrN2S — CID 62557850
N'-[(2-bromophenyl)methyl]-N'-methyl-N-(2-thiophen-3-ylethyl)ethane-1,2-diamine (PubChem CID 62557850) has the molecular formula C16H21BrN2S and a molecular weight of 353.33 g/mol. Its IUPAC name is N'-[(2-bromophenyl)methyl]-N'-methyl-N-(2-thiophen-3-ylethyl)ethane-1,2-diamine.
| Compound Name | N'-[(2-bromophenyl)methyl]-N'-methyl-N-(2-thiophen-3-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62557850 |
| Molecular Formula | C16H21BrN2S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N'-[(2-bromophenyl)methyl]-N'-methyl-N-(2-thiophen-3-ylethyl)ethane-1,2-diamine |
| SMILES | CN(CCNCCc1ccsc1)Cc1ccccc1Br |
| InChI | InChI=1S/C16H21BrN2S/c1-19(12-15-4-2-3-5-16(15)17)10-9-18-8-6-14-7-11-20-13-14/h2-5,7,11,13,18H,6,8-10,12H2,1H3 |
| InChIKey | XFPPRUFGKJRGSW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|