C11H16N2S — CID 62560587
N'-methyl-N-prop-2-ynyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine (PubChem CID 62560587) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is N'-methyl-N-prop-2-ynyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N-prop-2-ynyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62560587 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N'-methyl-N-prop-2-ynyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine |
| SMILES | C#CCNCCN(C)Cc1ccsc1 |
| InChI | InChI=1S/C11H16N2S/c1-3-5-12-6-7-13(2)9-11-4-8-14-10-11/h1,4,8,10,12H,5-7,9H2,2H3 |
| InChIKey | SQSZYMPBRUQHQF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|