C12H22N2S — CID 61386692
N'-methyl-N-propyl-N'-(thiophen-3-ylmethyl)propane-1,3-diamine (PubChem CID 61386692) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is N'-methyl-N-propyl-N'-(thiophen-3-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-methyl-N-propyl-N'-(thiophen-3-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 61386692 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N'-methyl-N-propyl-N'-(thiophen-3-ylmethyl)propane-1,3-diamine |
| SMILES | CCCNCCCN(C)Cc1ccsc1 |
| InChI | InChI=1S/C12H22N2S/c1-3-6-13-7-4-8-14(2)10-12-5-9-15-11-12/h5,9,11,13H,3-4,6-8,10H2,1-2H3 |
| InChIKey | NOOFDZXREKGOFQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|