C10H17NOS — CID 115883116
4-[methyl(thiophen-3-ylmethyl)amino]butan-2-ol (PubChem CID 115883116) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is 4-[methyl(thiophen-3-ylmethyl)amino]butan-2-ol.
| Compound Name | 4-[methyl(thiophen-3-ylmethyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 115883116 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-[methyl(thiophen-3-ylmethyl)amino]butan-2-ol |
| SMILES | CC(O)CCN(C)Cc1ccsc1 |
| InChI | InChI=1S/C10H17NOS/c1-9(12)3-5-11(2)7-10-4-6-13-8-10/h4,6,8-9,12H,3,5,7H2,1-2H3 |
| InChIKey | YVLBBPGNIRMPFK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |