C10H16BrNS — CID 64996092
3-bromo-N,2-dimethyl-N-(thiophen-3-ylmethyl)propan-1-amine (PubChem CID 64996092) has the molecular formula C10H16BrNS and a molecular weight of 262.22 g/mol. Its IUPAC name is 3-bromo-N,2-dimethyl-N-(thiophen-3-ylmethyl)propan-1-amine.
| Compound Name | 3-bromo-N,2-dimethyl-N-(thiophen-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 64996092 |
| Molecular Formula | C10H16BrNS |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 3-bromo-N,2-dimethyl-N-(thiophen-3-ylmethyl)propan-1-amine |
| SMILES | CC(CBr)CN(C)Cc1ccsc1 |
| InChI | InChI=1S/C10H16BrNS/c1-9(5-11)6-12(2)7-10-3-4-13-8-10/h3-4,8-9H,5-7H2,1-2H3 |
| InChIKey | WZYSUPWOZGFXAO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|