C9H15BrN2S — CID 64996041
3-bromo-N,2-dimethyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine (PubChem CID 64996041) has the molecular formula C9H15BrN2S and a molecular weight of 263.20 g/mol. Its IUPAC name is 3-bromo-N,2-dimethyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine.
| Compound Name | 3-bromo-N,2-dimethyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 64996041 |
| Molecular Formula | C9H15BrN2S |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 3-bromo-N,2-dimethyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
| SMILES | CC(CBr)CN(C)Cc1cscn1 |
| InChI | InChI=1S/C9H15BrN2S/c1-8(3-10)4-12(2)5-9-6-13-7-11-9/h6-8H,3-5H2,1-2H3 |
| InChIKey | VGMNVZYHDYMJIY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|