C14H26N2S2 — CID 105344114
9-[methyl(1,3-thiazol-4-ylmethyl)amino]nonane-1-thiol (PubChem CID 105344114) has the molecular formula C14H26N2S2 and a molecular weight of 286.51 g/mol. Its IUPAC name is 9-[methyl(1,3-thiazol-4-ylmethyl)amino]nonane-1-thiol.
| Compound Name | 9-[methyl(1,3-thiazol-4-ylmethyl)amino]nonane-1-thiol |
|---|---|
| PubChem CID | 105344114 |
| Molecular Formula | C14H26N2S2 |
| Molecular Weight | 286.51 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 9-[methyl(1,3-thiazol-4-ylmethyl)amino]nonane-1-thiol |
| SMILES | CN(CCCCCCCCCS)Cc1cscn1 |
| InChI | InChI=1S/C14H26N2S2/c1-16(11-14-12-18-13-15-14)9-7-5-3-2-4-6-8-10-17/h12-13,17H,2-11H2,1H3 |
| InChIKey | BYDJIVLFPKNXSE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 16.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|