C12H16ClN3S2 — CID 55012448
3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine (PubChem CID 55012448) has the molecular formula C12H16ClN3S2 and a molecular weight of 301.87 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine.
| Compound Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 55012448 |
| Molecular Formula | C12H16ClN3S2 |
| Molecular Weight | 301.87 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
| SMILES | CN(CCCc1nc(CCl)cs1)Cc1cscn1 |
| InChI | InChI=1S/C12H16ClN3S2/c1-16(6-11-7-17-9-14-11)4-2-3-12-15-10(5-13)8-18-12/h7-9H,2-6H2,1H3 |
| InChIKey | UIQYUNYAYRUFAA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.87 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|