C13H23ClN2O2S — CID 61418492
3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-bis(2-methoxyethyl)propan-1-amine (PubChem CID 61418492) has the molecular formula C13H23ClN2O2S and a molecular weight of 306.86 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-bis(2-methoxyethyl)propan-1-amine.
| Compound Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-bis(2-methoxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 61418492 |
| Molecular Formula | C13H23ClN2O2S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-bis(2-methoxyethyl)propan-1-amine |
| SMILES | COCCN(CCCc1nc(CCl)cs1)CCOC |
| InChI | InChI=1S/C13H23ClN2O2S/c1-17-8-6-16(7-9-18-2)5-3-4-13-15-12(10-14)11-19-13/h11H,3-10H2,1-2H3 |
| InChIKey | VZUIFWXURZHORT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|