C11H19ClN2OS — CID 63009656
N-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-3-methoxy-N-methylpropan-1-amine (PubChem CID 63009656) has the molecular formula C11H19ClN2OS and a molecular weight of 262.81 g/mol. Its IUPAC name is N-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-3-methoxy-N-methylpropan-1-amine.
| Compound Name | N-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-3-methoxy-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 63009656 |
| Molecular Formula | C11H19ClN2OS |
| Molecular Weight | 262.81 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-3-methoxy-N-methylpropan-1-amine |
| SMILES | COCCCN(C)CCc1nc(CCl)cs1 |
| InChI | InChI=1S/C11H19ClN2OS/c1-14(5-3-7-15-2)6-4-11-13-10(8-12)9-16-11/h9H,3-8H2,1-2H3 |
| InChIKey | WLOYLUMPEZXCNU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.81 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|