C11H18ClNOS — CID 43138174
4-(chloromethyl)-2-[3-(2-methylpropoxy)propyl]-1,3-thiazole (PubChem CID 43138174) has the molecular formula C11H18ClNOS and a molecular weight of 247.79 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[3-(2-methylpropoxy)propyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[3-(2-methylpropoxy)propyl]-1,3-thiazole |
|---|---|
| PubChem CID | 43138174 |
| Molecular Formula | C11H18ClNOS |
| Molecular Weight | 247.79 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-(chloromethyl)-2-[3-(2-methylpropoxy)propyl]-1,3-thiazole |
| SMILES | CC(C)COCCCc1nc(CCl)cs1 |
| InChI | InChI=1S/C11H18ClNOS/c1-9(2)7-14-5-3-4-11-13-10(6-12)8-15-11/h8-9H,3-7H2,1-2H3 |
| InChIKey | UASMREGLGONXKI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|