C10H13ClF3NOS — CID 54966697
4-(chloromethyl)-2-[4-(2,2,2-trifluoroethoxy)butyl]-1,3-thiazole (PubChem CID 54966697) has the molecular formula C10H13ClF3NOS and a molecular weight of 287.73 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[4-(2,2,2-trifluoroethoxy)butyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[4-(2,2,2-trifluoroethoxy)butyl]-1,3-thiazole |
|---|---|
| PubChem CID | 54966697 |
| Molecular Formula | C10H13ClF3NOS |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 4-(chloromethyl)-2-[4-(2,2,2-trifluoroethoxy)butyl]-1,3-thiazole |
| SMILES | FC(F)(F)COCCCCc1nc(CCl)cs1 |
| InChI | InChI=1S/C10H13ClF3NOS/c11-5-8-6-17-9(15-8)3-1-2-4-16-7-10(12,13)14/h6H,1-5,7H2 |
| InChIKey | IYBWLWUWACVCFY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|