C14H13ClF3NOS — CID 43320155
4-(chloromethyl)-2-[3-[4-(trifluoromethyl)phenoxy]propyl]-1,3-thiazole (PubChem CID 43320155) has the molecular formula C14H13ClF3NOS and a molecular weight of 335.78 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[3-[4-(trifluoromethyl)phenoxy]propyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[3-[4-(trifluoromethyl)phenoxy]propyl]-1,3-thiazole |
|---|---|
| PubChem CID | 43320155 |
| Molecular Formula | C14H13ClF3NOS |
| Molecular Weight | 335.78 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-(chloromethyl)-2-[3-[4-(trifluoromethyl)phenoxy]propyl]-1,3-thiazole |
| SMILES | FC(F)(F)c1ccc(OCCCc2nc(CCl)cs2)cc1 |
| InChI | InChI=1S/C14H13ClF3NOS/c15-8-11-9-21-13(19-11)2-1-7-20-12-5-3-10(4-6-12)14(16,17)18/h3-6,9H,1-2,7-8H2 |
| InChIKey | HCONRZRKTFXNRC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.78 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|