C13H12BrClFNOS — CID 83234147
2-[3-(3-bromo-4-fluorophenoxy)propyl]-4-(chloromethyl)-1,3-thiazole (PubChem CID 83234147) has the molecular formula C13H12BrClFNOS and a molecular weight of 364.67 g/mol. Its IUPAC name is 2-[3-(3-bromo-4-fluorophenoxy)propyl]-4-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-[3-(3-bromo-4-fluorophenoxy)propyl]-4-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 83234147 |
| Molecular Formula | C13H12BrClFNOS |
| Molecular Weight | 364.67 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | 2-[3-(3-bromo-4-fluorophenoxy)propyl]-4-(chloromethyl)-1,3-thiazole |
| SMILES | Fc1ccc(OCCCc2nc(CCl)cs2)cc1Br |
| InChI | InChI=1S/C13H12BrClFNOS/c14-11-6-10(3-4-12(11)16)18-5-1-2-13-17-9(7-15)8-19-13/h3-4,6,8H,1-2,5,7H2 |
| InChIKey | WOWYCFMJQNDUAM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|