C14H15ClFNOS — CID 64856397
4-(chloromethyl)-2-[3-(2-fluoro-5-methylphenoxy)propyl]-1,3-thiazole (PubChem CID 64856397) has the molecular formula C14H15ClFNOS and a molecular weight of 299.80 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[3-(2-fluoro-5-methylphenoxy)propyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[3-(2-fluoro-5-methylphenoxy)propyl]-1,3-thiazole |
|---|---|
| PubChem CID | 64856397 |
| Molecular Formula | C14H15ClFNOS |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-(chloromethyl)-2-[3-(2-fluoro-5-methylphenoxy)propyl]-1,3-thiazole |
| SMILES | Cc1ccc(F)c(OCCCc2nc(CCl)cs2)c1 |
| InChI | InChI=1S/C14H15ClFNOS/c1-10-4-5-12(16)13(7-10)18-6-2-3-14-17-11(8-15)9-19-14/h4-5,7,9H,2-3,6,8H2,1H3 |
| InChIKey | MIQXMYMBAJYTOM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|