C15H18ClNOS — CID 43138105
4-(chloromethyl)-2-[3-(2,5-dimethylphenoxy)propyl]-1,3-thiazole (PubChem CID 43138105) has the molecular formula C15H18ClNOS and a molecular weight of 295.84 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[3-(2,5-dimethylphenoxy)propyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[3-(2,5-dimethylphenoxy)propyl]-1,3-thiazole |
|---|---|
| PubChem CID | 43138105 |
| Molecular Formula | C15H18ClNOS |
| Molecular Weight | 295.84 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 4-(chloromethyl)-2-[3-(2,5-dimethylphenoxy)propyl]-1,3-thiazole |
| SMILES | Cc1ccc(C)c(OCCCc2nc(CCl)cs2)c1 |
| InChI | InChI=1S/C15H18ClNOS/c1-11-5-6-12(2)14(8-11)18-7-3-4-15-17-13(9-16)10-19-15/h5-6,8,10H,3-4,7,9H2,1-2H3 |
| InChIKey | FUCMEDMJMCAWRO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.84 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|