C12H11ClFNOS — CID 102982901
4-(chloromethyl)-2-[(5-fluoro-2-methylphenoxy)methyl]-1,3-thiazole (PubChem CID 102982901) has the molecular formula C12H11ClFNOS and a molecular weight of 271.74 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[(5-fluoro-2-methylphenoxy)methyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[(5-fluoro-2-methylphenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 102982901 |
| Molecular Formula | C12H11ClFNOS |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 4-(chloromethyl)-2-[(5-fluoro-2-methylphenoxy)methyl]-1,3-thiazole |
| SMILES | Cc1ccc(F)cc1OCc1nc(CCl)cs1 |
| InChI | InChI=1S/C12H11ClFNOS/c1-8-2-3-9(14)4-11(8)16-6-12-15-10(5-13)7-17-12/h2-4,7H,5-6H2,1H3 |
| InChIKey | MKHQTYMPCNASSR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|