C12H11F2NO2S — CID 94280933
2-[2-[(2,4-difluorophenoxy)methyl]-1,3-thiazol-4-yl]ethanol (PubChem CID 94280933) has the molecular formula C12H11F2NO2S and a molecular weight of 271.29 g/mol. Its IUPAC name is 2-[2-[(2,4-difluorophenoxy)methyl]-1,3-thiazol-4-yl]ethanol.
| Compound Name | 2-[2-[(2,4-difluorophenoxy)methyl]-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 94280933 |
| Molecular Formula | C12H11F2NO2S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-[2-[(2,4-difluorophenoxy)methyl]-1,3-thiazol-4-yl]ethanol |
| SMILES | OCCc1csc(COc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C12H11F2NO2S/c13-8-1-2-11(10(14)5-8)17-6-12-15-9(3-4-16)7-18-12/h1-2,5,7,16H,3-4,6H2 |
| InChIKey | VRHOUMMBYXSMNR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |