C10H8F2N2OS — CID 43137897
4-[(2,4-difluorophenoxy)methyl]-1,3-thiazol-2-amine (PubChem CID 43137897) has the molecular formula C10H8F2N2OS and a molecular weight of 242.25 g/mol. Its IUPAC name is 4-[(2,4-difluorophenoxy)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[(2,4-difluorophenoxy)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43137897 |
| Molecular Formula | C10H8F2N2OS |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 4-[(2,4-difluorophenoxy)methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(COc2ccc(F)cc2F)cs1 |
| InChI | InChI=1S/C10H8F2N2OS/c11-6-1-2-9(8(12)3-6)15-4-7-5-16-10(13)14-7/h1-3,5H,4H2,(H2,13,14) |
| InChIKey | AWVZMAQOAHBIBG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |