C10H7ClFNOS — CID 130552659
2-chloro-4-[(2-fluorophenoxy)methyl]-1,3-thiazole (PubChem CID 130552659) has the molecular formula C10H7ClFNOS and a molecular weight of 243.69 g/mol. Its IUPAC name is 2-chloro-4-[(2-fluorophenoxy)methyl]-1,3-thiazole.
| Compound Name | 2-chloro-4-[(2-fluorophenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 130552659 |
| Molecular Formula | C10H7ClFNOS |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 2-chloro-4-[(2-fluorophenoxy)methyl]-1,3-thiazole |
| SMILES | Fc1ccccc1OCc1csc(Cl)n1 |
| InChI | InChI=1S/C10H7ClFNOS/c11-10-13-7(6-15-10)5-14-9-4-2-1-3-8(9)12/h1-4,6H,5H2 |
| InChIKey | VECOFZVEOZZBRU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |