C16H12FNO2 — CID 78767820
4-[(2-fluorophenoxy)methyl]-2-phenyl-1,3-oxazole (PubChem CID 78767820) has the molecular formula C16H12FNO2 and a molecular weight of 269.28 g/mol. Its IUPAC name is 4-[(2-fluorophenoxy)methyl]-2-phenyl-1,3-oxazole.
| Compound Name | 4-[(2-fluorophenoxy)methyl]-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 78767820 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-[(2-fluorophenoxy)methyl]-2-phenyl-1,3-oxazole |
| SMILES | Fc1ccccc1OCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H12FNO2/c17-14-8-4-5-9-15(14)19-10-13-11-20-16(18-13)12-6-2-1-3-7-12/h1-9,11H,10H2 |
| InChIKey | FRSBHJSXFYKNNG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |