C16H12INO2 — CID 38879165
4-[(2-iodophenoxy)methyl]-2-phenyl-1,3-oxazole (PubChem CID 38879165) has the molecular formula C16H12INO2 and a molecular weight of 377.18 g/mol. Its IUPAC name is 4-[(2-iodophenoxy)methyl]-2-phenyl-1,3-oxazole.
| Compound Name | 4-[(2-iodophenoxy)methyl]-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 38879165 |
| Molecular Formula | C16H12INO2 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | 4-[(2-iodophenoxy)methyl]-2-phenyl-1,3-oxazole |
| SMILES | Ic1ccccc1OCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H12INO2/c17-14-8-4-5-9-15(14)19-10-13-11-20-16(18-13)12-6-2-1-3-7-12/h1-9,11H,10H2 |
| InChIKey | LENNFGQBPINOPF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|