C17H11FN2O2 — CID 31681304
2-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]benzonitrile (PubChem CID 31681304) has the molecular formula C17H11FN2O2 and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]benzonitrile.
| Compound Name | 2-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 31681304 |
| Molecular Formula | C17H11FN2O2 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCc1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H11FN2O2/c18-14-7-5-12(6-8-14)17-20-15(11-22-17)10-21-16-4-2-1-3-13(16)9-19/h1-8,11H,10H2 |
| InChIKey | WXSCNOMNHPCEKU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |