C17H12FNO3 — CID 10637727
3-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]benzaldehyde (PubChem CID 10637727) has the molecular formula C17H12FNO3 and a molecular weight of 297.29 g/mol. Its IUPAC name is 3-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]benzaldehyde.
| Compound Name | 3-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 10637727 |
| Molecular Formula | C17H12FNO3 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]benzaldehyde |
| SMILES | O=Cc1cccc(OCc2coc(-c3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C17H12FNO3/c18-14-6-4-13(5-7-14)17-19-15(11-22-17)10-21-16-3-1-2-12(8-16)9-20/h1-9,11H,10H2 |
| InChIKey | YNSPFGASTKGHOJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|