C18H17NO3 — CID 11140977
[3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methanol (PubChem CID 11140977) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is [3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methanol.
| Compound Name | [3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 11140977 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methanol |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1cccc(CO)c1 |
| InChI | InChI=1S/C18H17NO3/c1-13-17(12-21-16-9-5-6-14(10-16)11-20)19-18(22-13)15-7-3-2-4-8-15/h2-10,20H,11-12H2,1H3 |
| InChIKey | UPVJJOGZAKVERR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |