C29H28N2O5 — CID 173278465
2-methyl-4-[[3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-4-phenylbutanoic acid (PubChem CID 173278465) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is 2-methyl-4-[[3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-4-phenylbutanoic acid.
| Compound Name | 2-methyl-4-[[3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 173278465 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 2-methyl-4-[[3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-4-phenylbutanoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1cccc(CON=C(CC(C)C(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H28N2O5/c1-20(29(32)33)16-26(23-11-5-3-6-12-23)31-35-18-22-10-9-15-25(17-22)34-19-27-21(2)36-28(30-27)24-13-7-4-8-14-24/h3-15,17,20H,16,18-19H2,1-2H3,(H,32,33) |
| InChIKey | QDVBOMVOCHWQQR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|