C27H24N2O5 — CID 86589768
(2Z)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-3-phenylpropanoic acid (PubChem CID 86589768) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is (2Z)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-3-phenylpropanoic acid.
| Compound Name | (2Z)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 86589768 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (2Z)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-3-phenylpropanoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(CO/N=C(/Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C27H24N2O5/c1-19-25(28-26(34-19)22-10-6-3-7-11-22)18-32-23-14-12-21(13-15-23)17-33-29-24(27(30)31)16-20-8-4-2-5-9-20/h2-15H,16-18H2,1H3,(H,30,31)/b29-24- |
| InChIKey | MCFXSWYKSMPVFE-OLFWJLLRSA-N |
| XLogP | 5.43 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|