C31H32N2O5 — CID 86589823
ethyl (3E)-2,2-dimethyl-3-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-3-phenylpropanoate (PubChem CID 86589823) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is ethyl (3E)-2,2-dimethyl-3-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-3-phenylpropanoate.
| Compound Name | ethyl (3E)-2,2-dimethyl-3-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 86589823 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | ethyl (3E)-2,2-dimethyl-3-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(C)(C)/C(=N/OCc1ccc(OCc2nc(-c3ccccc3)oc2C)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H32N2O5/c1-5-35-30(34)31(3,4)28(24-12-8-6-9-13-24)33-37-20-23-16-18-26(19-17-23)36-21-27-22(2)38-29(32-27)25-14-10-7-11-15-25/h6-19H,5,20-21H2,1-4H3/b33-28+ |
| InChIKey | XQAYFIDFGDJMFS-PJJLUWSFSA-N |
| XLogP | 6.74 |
| TPSA | 83.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|