C24H26N2O5 — CID 11729518
(2E)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]hexanoic acid (PubChem CID 11729518) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is (2E)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]hexanoic acid.
| Compound Name | (2E)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]hexanoic acid |
|---|---|
| PubChem CID | 11729518 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (2E)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]hexanoic acid |
| SMILES | CCCC/C(=N\OCc1ccc(OCc2nc(-c3ccccc3)oc2C)cc1)C(=O)O |
| InChI | InChI=1S/C24H26N2O5/c1-3-4-10-21(24(27)28)26-30-15-18-11-13-20(14-12-18)29-16-22-17(2)31-23(25-22)19-8-6-5-7-9-19/h5-9,11-14H,3-4,10,15-16H2,1-2H3,(H,27,28)/b26-21+ |
| InChIKey | ORCYFJIVDXIAFM-YYADALCUSA-N |
| XLogP | 5.38 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|