C34H38N2O5 — CID 11092886
ethyl (8E)-8-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-8-phenyloctanoate (PubChem CID 11092886) has the molecular formula C34H38N2O5 and a molecular weight of 554.69 g/mol. Its IUPAC name is ethyl (8E)-8-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-8-phenyloctanoate.
| Compound Name | ethyl (8E)-8-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-8-phenyloctanoate |
|---|---|
| PubChem CID | 11092886 |
| Molecular Formula | C34H38N2O5 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | ethyl (8E)-8-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-8-phenyloctanoate |
| SMILES | CCOC(=O)CCCCCC/C(=N\OCc1ccc(OCc2nc(-c3ccccc3)oc2C)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H38N2O5/c1-3-38-33(37)19-13-5-4-12-18-31(28-14-8-6-9-15-28)36-40-24-27-20-22-30(23-21-27)39-25-32-26(2)41-34(35-32)29-16-10-7-11-17-29/h6-11,14-17,20-23H,3-5,12-13,18-19,24-25H2,1-2H3/b36-31+ |
| InChIKey | NWHWYDKKZPKFLX-XKMRCYARSA-N |
| XLogP | 8.05 |
| TPSA | 83.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|