C34H30N2O6 — CID 10940719
ethyl (2Z)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-2-(3-phenoxyphenyl)acetate (PubChem CID 10940719) has the molecular formula C34H30N2O6 and a molecular weight of 562.62 g/mol. Its IUPAC name is ethyl (2Z)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-2-(3-phenoxyphenyl)acetate.
| Compound Name | ethyl (2Z)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-2-(3-phenoxyphenyl)acetate |
|---|---|
| PubChem CID | 10940719 |
| Molecular Formula | C34H30N2O6 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | ethyl (2Z)-2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-2-(3-phenoxyphenyl)acetate |
| SMILES | CCOC(=O)/C(=N\OCc1ccc(OCc2nc(-c3ccccc3)oc2C)cc1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C34H30N2O6/c1-3-38-34(37)32(27-13-10-16-30(21-27)42-29-14-8-5-9-15-29)36-40-22-25-17-19-28(20-18-25)39-23-31-24(2)41-33(35-31)26-11-6-4-7-12-26/h4-21H,3,22-23H2,1-2H3/b36-32- |
| InChIKey | QOHCGEGUUFJZRZ-HIELXXDYSA-N |
| XLogP | 7.51 |
| TPSA | 92.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|